C28H34N2O8 — CID 170199921
1-O-(2-methylbutan-2-yl) 4-O-[4-[2-(4-nitrophenyl)propan-2-yloxycarbonyl]phenyl] piperidine-1,4-dicarboxylate (PubChem CID 170199921) has the molecular formula C28H34N2O8 and a molecular weight of 526.59 g/mol. Its IUPAC name is 1-O-(2-methylbutan-2-yl) 4-O-[4-[2-(4-nitrophenyl)propan-2-yloxycarbonyl]phenyl] piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-(2-methylbutan-2-yl) 4-O-[4-[2-(4-nitrophenyl)propan-2-yloxycarbonyl]phenyl] piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 170199921 |
| Molecular Formula | C28H34N2O8 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 1-O-(2-methylbutan-2-yl) 4-O-[4-[2-(4-nitrophenyl)propan-2-yloxycarbonyl]phenyl] piperidine-1,4-dicarboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCC(C(=O)Oc2ccc(C(=O)OC(C)(C)c3ccc([N+](=O)[O-])cc3)cc2)CC1 |
| InChI | InChI=1S/C28H34N2O8/c1-6-27(2,3)38-26(33)29-17-15-20(16-18-29)24(31)36-23-13-7-19(8-14-23)25(32)37-28(4,5)21-9-11-22(12-10-21)30(34)35/h7-14,20H,6,15-18H2,1-5H3 |
| InChIKey | ZDPSIGOGIRKTSW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|