C18H31N5O3 — CID 170201705
2-(2-methylpropanoyl)-6-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]hexanamide (PubChem CID 170201705) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-(2-methylpropanoyl)-6-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]hexanamide.
| Compound Name | 2-(2-methylpropanoyl)-6-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]hexanamide |
|---|---|
| PubChem CID | 170201705 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 2-(2-methylpropanoyl)-6-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]hexanamide |
| SMILES | CC(C)C(=O)C(CCCCNC(=O)CCc1cn(C(C)C)nn1)C(N)=O |
| InChI | InChI=1S/C18H31N5O3/c1-12(2)17(25)15(18(19)26)7-5-6-10-20-16(24)9-8-14-11-23(13(3)4)22-21-14/h11-13,15H,5-10H2,1-4H3,(H2,19,26)(H,20,24) |
| InChIKey | RCICBSYVLAJVCR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|