C34H66N8O6 — CID 171080126
ethane;6-[3-[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]propanoylamino]-2-(2-methylpropanoyl)hexanamide;2-(methylamino)-6-(4-methylpentanoylamino)hexanamide (PubChem CID 171080126) has the molecular formula C34H66N8O6 and a molecular weight of 682.95 g/mol. Its IUPAC name is ethane;6-[3-[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]propanoylamino]-2-(2-methylpropanoyl)hexanamide;2-(methylamino)-6-(4-methylpentanoylamino)hexanamide.
| Compound Name | ethane;6-[3-[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]propanoylamino]-2-(2-methylpropanoyl)hexanamide;2-(methylamino)-6-(4-methylpentanoylamino)hexanamide |
|---|---|
| PubChem CID | 171080126 |
| Molecular Formula | C34H66N8O6 |
| Molecular Weight | 682.95 g/mol |
| Exact Mass | 682.51 |
| IUPAC Name | ethane;6-[3-[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]propanoylamino]-2-(2-methylpropanoyl)hexanamide;2-(methylamino)-6-(4-methylpentanoylamino)hexanamide |
| SMILES | CC.CC(C)C(=O)C(CCCCNC(=O)CCc1cn(C(C)(C)CO)nn1)C(N)=O.CNC(CCCCNC(=O)CCC(C)C)C(N)=O |
| InChI | InChI=1S/C19H33N5O4.C13H27N3O2.C2H6/c1-13(2)17(27)15(18(20)28)7-5-6-10-21-16(26)9-8-14-11-24(23-22-14)19(3,4)12-25;1-10(2)7-8-12(17)16-9-5-4-6-11(15-3)13(14)18;1-2/h11,13,15,25H,5-10,12H2,1-4H3,(H2,20,28)(H,21,26);10-11,15H,4-9H2,1-3H3,(H2,14,18)(H,16,17);1-2H3 |
| InChIKey | PZWDNICBLMOHFY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 224.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.95 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|