C18H24N4O4 — CID 58933352
methyl 3-(4-hydroxyphenyl)-2-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]propanoate (PubChem CID 58933352) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl 3-(4-hydroxyphenyl)-2-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]propanoate.
| Compound Name | methyl 3-(4-hydroxyphenyl)-2-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 58933352 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl 3-(4-hydroxyphenyl)-2-[3-(1-propan-2-yltriazol-4-yl)propanoylamino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)NC(=O)CCc1cn(C(C)C)nn1 |
| InChI | InChI=1S/C18H24N4O4/c1-12(2)22-11-14(20-21-22)6-9-17(24)19-16(18(25)26-3)10-13-4-7-15(23)8-5-13/h4-5,7-8,11-12,16,23H,6,9-10H2,1-3H3,(H,19,24) |
| InChIKey | XGGWHLSETZJQOE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |