C23H24Cl2N4O2S — CID 170207626
methyl 3-[(3S)-7-chloro-5-(2-chlorophenyl)-2-imino-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate (PubChem CID 170207626) has the molecular formula C23H24Cl2N4O2S and a molecular weight of 491.44 g/mol. Its IUPAC name is methyl 3-[(3S)-7-chloro-5-(2-chlorophenyl)-2-imino-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate.
| Compound Name | methyl 3-[(3S)-7-chloro-5-(2-chlorophenyl)-2-imino-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate |
|---|---|
| PubChem CID | 170207626 |
| Molecular Formula | C23H24Cl2N4O2S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | methyl 3-[(3S)-7-chloro-5-(2-chlorophenyl)-2-imino-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate |
| SMILES | [H]/N=C(\SCCC)N1/C(=N/[H])[C@H](CCC(=O)OC)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H24Cl2N4O2S/c1-3-12-32-23(27)29-19-10-8-14(24)13-16(19)21(15-6-4-5-7-17(15)25)28-18(22(29)26)9-11-20(30)31-2/h4-8,10,13,18,26-27H,3,9,11-12H2,1-2H3/b26-22+,27-23-/t18-/m0/s1 |
| InChIKey | WFRYCWJCDPJJSI-KQBSOPMTSA-N |
| XLogP | 6.03 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|