C21H20ClFN4O2S — CID 170208520
methyl 3-[(3S)-7-chloro-5-(2-fluorophenyl)-2-imino-1-(C-methylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate (PubChem CID 170208520) has the molecular formula C21H20ClFN4O2S and a molecular weight of 446.94 g/mol. Its IUPAC name is methyl 3-[(3S)-7-chloro-5-(2-fluorophenyl)-2-imino-1-(C-methylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate.
| Compound Name | methyl 3-[(3S)-7-chloro-5-(2-fluorophenyl)-2-imino-1-(C-methylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate |
|---|---|
| PubChem CID | 170208520 |
| Molecular Formula | C21H20ClFN4O2S |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | methyl 3-[(3S)-7-chloro-5-(2-fluorophenyl)-2-imino-1-(C-methylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate |
| SMILES | [H]/N=C(\SC)N1/C(=N/[H])[C@H](CCC(=O)OC)N=C(c2ccccc2F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H20ClFN4O2S/c1-29-18(28)10-8-16-20(24)27(21(25)30-2)17-9-7-12(22)11-14(17)19(26-16)13-5-3-4-6-15(13)23/h3-7,9,11,16,24-25H,8,10H2,1-2H3/b24-20+,25-21-/t16-/m0/s1 |
| InChIKey | KASAYBIVAKFMGC-YHGWRFRFSA-N |
| XLogP | 4.73 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|