C21H23N5O7 — CID 170210675
(2S,6S)-7-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-5,6-dihydroxy-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 170210675) has the molecular formula C21H23N5O7 and a molecular weight of 457.44 g/mol. Its IUPAC name is (2S,6S)-7-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-5,6-dihydroxy-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (2S,6S)-7-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-5,6-dihydroxy-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 170210675 |
| Molecular Formula | C21H23N5O7 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2S,6S)-7-amino-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-5,6-dihydroxy-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NN1C2C[C@H](C(=O)NCc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)C1[C@H](O)C2O |
| InChI | InChI=1S/C21H23N5O7/c22-26-12-6-10(15(26)17(29)16(12)28)18(30)23-7-8-2-1-3-9-14(8)21(33)25(20(9)32)11-4-5-13(27)24-19(11)31/h1-3,10-12,15-17,28-29H,4-7,22H2,(H,23,30)(H,24,27,31)/t10-,11?,12?,15?,16?,17-/m0/s1 |
| InChIKey | KNQZVIHPIJPSFQ-VCFRVENESA-N |
| XLogP | -2.63 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|