C31H49NO4 — CID 170213916
(2,5-dioxopyrrolidin-1-yl) (Z)-17-(1-adamantyl)heptadec-9-enoate (PubChem CID 170213916) has the molecular formula C31H49NO4 and a molecular weight of 499.74 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (Z)-17-(1-adamantyl)heptadec-9-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (Z)-17-(1-adamantyl)heptadec-9-enoate |
|---|---|
| PubChem CID | 170213916 |
| Molecular Formula | C31H49NO4 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.37 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (Z)-17-(1-adamantyl)heptadec-9-enoate |
| SMILES | O=C(CCCCCCC/C=C\CCCCCCCC12CC3CC(CC(C3)C1)C2)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C31H49NO4/c33-28-16-17-29(34)32(28)36-30(35)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-18-31-22-25-19-26(23-31)21-27(20-25)24-31/h1-2,25-27H,3-24H2/b2-1- |
| InChIKey | RUVKFNIAASKNSA-UPHRSURJSA-N |
| XLogP | 7.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|