C52H90N2O6 — CID 88586181
(2,5-dioxopyrrolidin-1-yl) 6-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]hexanoate (PubChem CID 88586181) has the molecular formula C52H90N2O6 and a molecular weight of 839.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]hexanoate |
|---|---|
| PubChem CID | 88586181 |
| Molecular Formula | C52H90N2O6 |
| Molecular Weight | 839.30 g/mol |
| Exact Mass | 838.68 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethyl-methylamino]hexanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCN(C)CCCCCC(=O)ON2C(=O)CCC2=O)O1 |
| InChI | InChI=1S/C52H90N2O6/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-36-43-52(44-37-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2)58-47-48(59-52)42-46-53(3)45-38-34-35-39-51(57)60-54-49(55)40-41-50(54)56/h12-15,18-21,48H,4-11,16-17,22-47H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | VVYUFZJKPJHJIX-QYCRHRGJSA-N |
| XLogP | 13.99 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.30 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|