C45H84N4O2 — CID 76686253
2-[2-[2-[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]ethyl-methylamino]ethyl]guanidine (PubChem CID 76686253) has the molecular formula C45H84N4O2 and a molecular weight of 713.19 g/mol. Its IUPAC name is 2-[2-[2-[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]ethyl-methylamino]ethyl]guanidine.
| Compound Name | 2-[2-[2-[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]ethyl-methylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 76686253 |
| Molecular Formula | C45H84N4O2 |
| Molecular Weight | 713.19 g/mol |
| Exact Mass | 712.66 |
| IUPAC Name | 2-[2-[2-[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]ethyl-methylamino]ethyl]guanidine |
| SMILES | CCCCCC=CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CCCCCC)OCC(CCN(C)CCN=C(N)N)O1 |
| InChI | InChI=1S/C45H84N4O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-45(50-42-43(51-45)36-40-49(3)41-39-48-44(46)47)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,43H,4-11,16-17,22-42H2,1-3H3,(H4,46,47,48) |
| InChIKey | JGCWMCRYIWKFEG-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.19 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|