C44H82N4O2 — CID 58069475
2-[2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl-methylamino]ethyl]guanidine (PubChem CID 58069475) has the molecular formula C44H82N4O2 and a molecular weight of 699.17 g/mol. Its IUPAC name is 2-[2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl-methylamino]ethyl]guanidine.
| Compound Name | 2-[2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl-methylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 58069475 |
| Molecular Formula | C44H82N4O2 |
| Molecular Weight | 699.17 g/mol |
| Exact Mass | 698.64 |
| IUPAC Name | 2-[2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl-methylamino]ethyl]guanidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CN(C)CCN=C(N)N)O1 |
| InChI | InChI=1S/C44H82N4O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-44(49-41-42(50-44)40-48(3)39-38-47-43(45)46)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,42H,4-11,16-17,22-41H2,1-3H3,(H4,45,46,47)/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | NDJSDIAMFQHIKE-QYCRHRGJSA-N |
| XLogP | 11.71 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.17 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|