C47H85NO4 — CID 76686099
6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoic acid (PubChem CID 76686099) has the molecular formula C47H85NO4 and a molecular weight of 728.20 g/mol. Its IUPAC name is 6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoic acid.
| Compound Name | 6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoic acid |
|---|---|
| PubChem CID | 76686099 |
| Molecular Formula | C47H85NO4 |
| Molecular Weight | 728.20 g/mol |
| Exact Mass | 727.65 |
| IUPAC Name | 6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CCCCCC)OCC(CN(C)CCCCCC(=O)O)O1 |
| InChI | InChI=1S/C47H85NO4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-36-40-47(51-44-45(52-47)43-48(3)42-38-34-35-39-46(49)50)41-37-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,45H,4-11,16-17,22-44H2,1-3H3,(H,49,50) |
| InChIKey | UTRMORPXJMOMOG-UHFFFAOYSA-N |
| XLogP | 14.08 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.20 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|