C51H88N2O6 — CID 123388783
(2,5-dihydroxypyrrol-1-yl) 6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoate (PubChem CID 123388783) has the molecular formula C51H88N2O6 and a molecular weight of 825.27 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoate |
|---|---|
| PubChem CID | 123388783 |
| Molecular Formula | C51H88N2O6 |
| Molecular Weight | 825.27 g/mol |
| Exact Mass | 824.66 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[[2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolan-4-yl]methyl-methylamino]hexanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CCCCCC)OCC(CN(C)CCCCCC(=O)On2c(O)ccc2O)O1 |
| InChI | InChI=1S/C51H88N2O6/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-36-42-51(43-37-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2)57-46-47(58-51)45-52(3)44-38-34-35-39-50(56)59-53-48(54)40-41-49(53)55/h12-15,18-21,40-41,47,54-55H,4-11,16-17,22-39,42-46H2,1-3H3 |
| InChIKey | CMZGUWVDBSHDDW-UHFFFAOYSA-N |
| XLogP | 13.87 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.27 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|