C49H80O4 — CID 58069647
benzyl 3-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]propanoate (PubChem CID 58069647) has the molecular formula C49H80O4 and a molecular weight of 733.17 g/mol. Its IUPAC name is benzyl 3-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]propanoate.
| Compound Name | benzyl 3-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 58069647 |
| Molecular Formula | C49H80O4 |
| Molecular Weight | 733.17 g/mol |
| Exact Mass | 732.61 |
| IUPAC Name | benzyl 3-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC[C@H](CCC(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C49H80O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-42-49(43-37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)52-45-47(53-49)40-41-48(50)51-44-46-38-34-33-35-39-46/h11-14,17-20,33-35,38-39,47H,3-10,15-16,21-32,36-37,40-45H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t47-/m0/s1 |
| InChIKey | HIRLJJSTVZOECJ-DBGDCHCHSA-N |
| XLogP | 15.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.17 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|