C46H82N2O11S — CID 170214674
[(Z)-3-[3-[3-(dimethylamino)propylsulfanylcarbonyl-[3-(3-nonanoyloxypropoxy)-3-oxopropyl]amino]propanoyloxy]-1-nonanoyloxyprop-1-en-2-yl] decanoate (PubChem CID 170214674) has the molecular formula C46H82N2O11S and a molecular weight of 871.23 g/mol. Its IUPAC name is [(Z)-3-[3-[3-(dimethylamino)propylsulfanylcarbonyl-[3-(3-nonanoyloxypropoxy)-3-oxopropyl]amino]propanoyloxy]-1-nonanoyloxyprop-1-en-2-yl] decanoate.
| Compound Name | [(Z)-3-[3-[3-(dimethylamino)propylsulfanylcarbonyl-[3-(3-nonanoyloxypropoxy)-3-oxopropyl]amino]propanoyloxy]-1-nonanoyloxyprop-1-en-2-yl] decanoate |
|---|---|
| PubChem CID | 170214674 |
| Molecular Formula | C46H82N2O11S |
| Molecular Weight | 871.23 g/mol |
| Exact Mass | 870.56 |
| IUPAC Name | [(Z)-3-[3-[3-(dimethylamino)propylsulfanylcarbonyl-[3-(3-nonanoyloxypropoxy)-3-oxopropyl]amino]propanoyloxy]-1-nonanoyloxyprop-1-en-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O/C(=C\OC(=O)CCCCCCCC)COC(=O)CCN(CCC(=O)OCCCOC(=O)CCCCCCCC)C(=O)SCCCN(C)C |
| InChI | InChI=1S/C46H82N2O11S/c1-6-9-12-15-18-21-24-29-45(53)59-40(38-57-42(50)28-23-20-17-14-11-8-3)39-58-44(52)31-34-48(46(54)60-37-25-32-47(4)5)33-30-43(51)56-36-26-35-55-41(49)27-22-19-16-13-10-7-2/h38H,6-37,39H2,1-5H3/b40-38- |
| InChIKey | NBISAHOMQMEEJG-QMRMMQACSA-N |
| XLogP | 10.46 |
| TPSA | 155.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.23 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|