C50H90N2O13S — CID 172522276
[2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-[1,3-di(nonanoyloxy)propan-2-yloxy]-2-oxoethyl]amino]acetyl]oxy-3-heptanoyloxypropyl] nonanoate (PubChem CID 172522276) has the molecular formula C50H90N2O13S and a molecular weight of 959.34 g/mol. Its IUPAC name is [2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-[1,3-di(nonanoyloxy)propan-2-yloxy]-2-oxoethyl]amino]acetyl]oxy-3-heptanoyloxypropyl] nonanoate.
| Compound Name | [2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-[1,3-di(nonanoyloxy)propan-2-yloxy]-2-oxoethyl]amino]acetyl]oxy-3-heptanoyloxypropyl] nonanoate |
|---|---|
| PubChem CID | 172522276 |
| Molecular Formula | C50H90N2O13S |
| Molecular Weight | 959.34 g/mol |
| Exact Mass | 958.62 |
| IUPAC Name | [2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-[1,3-di(nonanoyloxy)propan-2-yloxy]-2-oxoethyl]amino]acetyl]oxy-3-heptanoyloxypropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OCC(COC(=O)CCCCCC)OC(=O)CN(CC(=O)OC(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC)C(=O)SCCCN(C)C |
| InChI | InChI=1S/C50H90N2O13S/c1-7-11-15-19-22-26-31-45(54)61-39-42(38-60-44(53)30-25-18-14-10-4)64-48(57)36-52(50(59)66-35-29-34-51(5)6)37-49(58)65-43(40-62-46(55)32-27-23-20-16-12-8-2)41-63-47(56)33-28-24-21-17-13-9-3/h42-43H,7-41H2,1-6H3 |
| InChIKey | CDSCTJREUHMYHF-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 181.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.34 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|