C18H32N2O10S — CID 172587517
1,3-dihydroxypropan-2-yl 2-[[2-(1-acetyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]-[3-(dimethylamino)propylsulfanylcarbonyl]amino]acetate (PubChem CID 172587517) has the molecular formula C18H32N2O10S and a molecular weight of 468.53 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 2-[[2-(1-acetyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]-[3-(dimethylamino)propylsulfanylcarbonyl]amino]acetate.
| Compound Name | 1,3-dihydroxypropan-2-yl 2-[[2-(1-acetyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]-[3-(dimethylamino)propylsulfanylcarbonyl]amino]acetate |
|---|---|
| PubChem CID | 172587517 |
| Molecular Formula | C18H32N2O10S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 2-[[2-(1-acetyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]-[3-(dimethylamino)propylsulfanylcarbonyl]amino]acetate |
| SMILES | CC(=O)OCC(CO)OC(=O)CN(CC(=O)OC(CO)CO)C(=O)SCCCN(C)C |
| InChI | InChI=1S/C18H32N2O10S/c1-13(24)28-12-15(11-23)30-17(26)8-20(7-16(25)29-14(9-21)10-22)18(27)31-6-4-5-19(2)3/h14-15,21-23H,4-12H2,1-3H3 |
| InChIKey | VLXDSSKLFHXZHX-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|