C26H50N2O5S — CID 135134931
methyl 2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-hexadecan-8-yloxy-2-oxoethyl)amino]acetate (PubChem CID 135134931) has the molecular formula C26H50N2O5S and a molecular weight of 502.76 g/mol. Its IUPAC name is methyl 2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-hexadecan-8-yloxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-hexadecan-8-yloxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 135134931 |
| Molecular Formula | C26H50N2O5S |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | methyl 2-[2-(dimethylamino)ethylsulfanylcarbonyl-(2-hexadecan-8-yloxy-2-oxoethyl)amino]acetate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)CN(CC(=O)OC)C(=O)SCCN(C)C |
| InChI | InChI=1S/C26H50N2O5S/c1-6-8-10-12-14-16-18-23(17-15-13-11-9-7-2)33-25(30)22-28(21-24(29)32-5)26(31)34-20-19-27(3)4/h23H,6-22H2,1-5H3 |
| InChIKey | JERIPBFBUKGUSI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|