C40H78N2O5S — CID 142388207
pentadecan-8-yl 2-[3-(ethylamino)propylsulfanylcarbonyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate (PubChem CID 142388207) has the molecular formula C40H78N2O5S and a molecular weight of 699.14 g/mol. Its IUPAC name is pentadecan-8-yl 2-[3-(ethylamino)propylsulfanylcarbonyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate.
| Compound Name | pentadecan-8-yl 2-[3-(ethylamino)propylsulfanylcarbonyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate |
|---|---|
| PubChem CID | 142388207 |
| Molecular Formula | C40H78N2O5S |
| Molecular Weight | 699.14 g/mol |
| Exact Mass | 698.56 |
| IUPAC Name | pentadecan-8-yl 2-[3-(ethylamino)propylsulfanylcarbonyl-(2-oxo-2-pentadecan-8-yloxyethyl)amino]acetate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)CN(CC(=O)OC(CCCCCCC)CCCCCCC)C(=O)SCCCNCC |
| InChI | InChI=1S/C40H78N2O5S/c1-6-11-15-19-23-28-36(29-24-20-16-12-7-2)46-38(43)34-42(40(45)48-33-27-32-41-10-5)35-39(44)47-37(30-25-21-17-13-8-3)31-26-22-18-14-9-4/h36-37,41H,6-35H2,1-5H3 |
| InChIKey | HOXDLUXSHSLIGY-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.14 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|