C31H59N3O3S — CID 170645868
hexadecan-8-yl 4-[butyl-[3-[[(Z)-2-(methylideneamino)ethenyl]amino]propylsulfanylcarbonyl]amino]butanoate (PubChem CID 170645868) has the molecular formula C31H59N3O3S and a molecular weight of 553.90 g/mol. Its IUPAC name is hexadecan-8-yl 4-[butyl-[3-[[(Z)-2-(methylideneamino)ethenyl]amino]propylsulfanylcarbonyl]amino]butanoate.
| Compound Name | hexadecan-8-yl 4-[butyl-[3-[[(Z)-2-(methylideneamino)ethenyl]amino]propylsulfanylcarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 170645868 |
| Molecular Formula | C31H59N3O3S |
| Molecular Weight | 553.90 g/mol |
| Exact Mass | 553.43 |
| IUPAC Name | hexadecan-8-yl 4-[butyl-[3-[[(Z)-2-(methylideneamino)ethenyl]amino]propylsulfanylcarbonyl]amino]butanoate |
| SMILES | C=N/C=C\NCCCSC(=O)N(CCCC)CCCC(=O)OC(CCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C31H59N3O3S/c1-5-8-11-13-15-17-21-29(20-16-14-12-9-6-2)37-30(35)22-18-27-34(26-10-7-3)31(36)38-28-19-23-33-25-24-32-4/h24-25,29,33H,4-23,26-28H2,1-3H3/b25-24- |
| InChIKey | XOLHRPGJUVSFEI-IZHYLOQSSA-N |
| XLogP | 8.90 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.90 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|