C28H52N2O5S — CID 170077175
[(Z)-non-2-enyl] 2-[3-aminopropylsulfanylcarbonyl-(2-oxo-2-undecan-6-yloxyethyl)amino]acetate (PubChem CID 170077175) has the molecular formula C28H52N2O5S and a molecular weight of 528.80 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 2-[3-aminopropylsulfanylcarbonyl-(2-oxo-2-undecan-6-yloxyethyl)amino]acetate.
| Compound Name | [(Z)-non-2-enyl] 2-[3-aminopropylsulfanylcarbonyl-(2-oxo-2-undecan-6-yloxyethyl)amino]acetate |
|---|---|
| PubChem CID | 170077175 |
| Molecular Formula | C28H52N2O5S |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | [(Z)-non-2-enyl] 2-[3-aminopropylsulfanylcarbonyl-(2-oxo-2-undecan-6-yloxyethyl)amino]acetate |
| SMILES | CCCCCC/C=C\COC(=O)CN(CC(=O)OC(CCCCC)CCCCC)C(=O)SCCCN |
| InChI | InChI=1S/C28H52N2O5S/c1-4-7-10-11-12-13-16-21-34-26(31)23-30(28(33)36-22-17-20-29)24-27(32)35-25(18-14-8-5-2)19-15-9-6-3/h13,16,25H,4-12,14-15,17-24,29H2,1-3H3/b16-13- |
| InChIKey | FDEOBZZZHNIUDS-SSZFMOIBSA-N |
| XLogP | 6.63 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|