C24H45NO4 — CID 135130652
[(Z)-non-2-enyl] 2-[(2-oxo-2-undecan-6-yloxyethyl)amino]acetate (PubChem CID 135130652) has the molecular formula C24H45NO4 and a molecular weight of 411.63 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 2-[(2-oxo-2-undecan-6-yloxyethyl)amino]acetate.
| Compound Name | [(Z)-non-2-enyl] 2-[(2-oxo-2-undecan-6-yloxyethyl)amino]acetate |
|---|---|
| PubChem CID | 135130652 |
| Molecular Formula | C24H45NO4 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | [(Z)-non-2-enyl] 2-[(2-oxo-2-undecan-6-yloxyethyl)amino]acetate |
| SMILES | CCCCCC/C=C\COC(=O)CNCC(=O)OC(CCCCC)CCCCC |
| InChI | InChI=1S/C24H45NO4/c1-4-7-10-11-12-13-16-19-28-23(26)20-25-21-24(27)29-22(17-14-8-5-2)18-15-9-6-3/h13,16,22,25H,4-12,14-15,17-21H2,1-3H3/b16-13- |
| InChIKey | KWPUMPDSPRGEPD-SSZFMOIBSA-N |
| XLogP | 5.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|