C33H57NO5 — CID 174176530
[(Z)-non-2-enyl] 4-[formyl-[4-oxo-4-[(4E,11E)-pentadeca-4,11-dien-8-yl]oxybutyl]amino]butanoate (PubChem CID 174176530) has the molecular formula C33H57NO5 and a molecular weight of 547.82 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 4-[formyl-[4-oxo-4-[(4E,11E)-pentadeca-4,11-dien-8-yl]oxybutyl]amino]butanoate.
| Compound Name | [(Z)-non-2-enyl] 4-[formyl-[4-oxo-4-[(4E,11E)-pentadeca-4,11-dien-8-yl]oxybutyl]amino]butanoate |
|---|---|
| PubChem CID | 174176530 |
| Molecular Formula | C33H57NO5 |
| Molecular Weight | 547.82 g/mol |
| Exact Mass | 547.42 |
| IUPAC Name | [(Z)-non-2-enyl] 4-[formyl-[4-oxo-4-[(4E,11E)-pentadeca-4,11-dien-8-yl]oxybutyl]amino]butanoate |
| SMILES | CCC/C=C/CCC(CC/C=C/CCC)OC(=O)CCCN(C=O)CCCC(=O)OC/C=C\CCCCCC |
| InChI | InChI=1S/C33H57NO5/c1-4-7-10-13-14-17-20-29-38-32(36)25-21-27-34(30-35)28-22-26-33(37)39-31(23-18-15-11-8-5-2)24-19-16-12-9-6-3/h11-12,15-17,20,30-31H,4-10,13-14,18-19,21-29H2,1-3H3/b15-11+,16-12+,20-17- |
| InChIKey | OSGCVAOFIUYEIG-UEBPGFRVSA-N |
| XLogP | 8.26 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.82 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|