C23H38N2O12S — CID 172587393
[2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-(1-formyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]amino]acetyl]oxy-3-propanoyloxypropyl] propanoate (PubChem CID 172587393) has the molecular formula C23H38N2O12S and a molecular weight of 566.63 g/mol. Its IUPAC name is [2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-(1-formyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]amino]acetyl]oxy-3-propanoyloxypropyl] propanoate.
| Compound Name | [2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-(1-formyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]amino]acetyl]oxy-3-propanoyloxypropyl] propanoate |
|---|---|
| PubChem CID | 172587393 |
| Molecular Formula | C23H38N2O12S |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [2-[2-[3-(dimethylamino)propylsulfanylcarbonyl-[2-(1-formyloxy-3-hydroxypropan-2-yl)oxy-2-oxoethyl]amino]acetyl]oxy-3-propanoyloxypropyl] propanoate |
| SMILES | CCC(=O)OCC(COC(=O)CC)OC(=O)CN(CC(=O)OC(CO)COC=O)C(=O)SCCCN(C)C |
| InChI | InChI=1S/C23H38N2O12S/c1-5-19(28)34-14-18(15-35-20(29)6-2)37-22(31)11-25(23(32)38-9-7-8-24(3)4)10-21(30)36-17(12-26)13-33-16-27/h16-18,26H,5-15H2,1-4H3 |
| InChIKey | XCRMTPYREJZEDU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|