C19H38N2O2 — CID 170222496
(3R)-4-ethyl-6,6-dimethyl-3-(octanoylamino)heptanamide (PubChem CID 170222496) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is (3R)-4-ethyl-6,6-dimethyl-3-(octanoylamino)heptanamide.
| Compound Name | (3R)-4-ethyl-6,6-dimethyl-3-(octanoylamino)heptanamide |
|---|---|
| PubChem CID | 170222496 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | (3R)-4-ethyl-6,6-dimethyl-3-(octanoylamino)heptanamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(CC)CC(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-6-8-9-10-11-12-18(23)21-16(13-17(20)22)15(7-2)14-19(3,4)5/h15-16H,6-14H2,1-5H3,(H2,20,22)(H,21,23)/t15?,16-/m1/s1 |
| InChIKey | OXXOVQJXBXADON-OEMAIJDKSA-N |
| XLogP | 4.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|