C15H28F3N3O2 — CID 166884715
N-[5-amino-2-(ethylamino)-1,1,1-trifluoro-5-oxopentan-3-yl]octanamide (PubChem CID 166884715) has the molecular formula C15H28F3N3O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[5-amino-2-(ethylamino)-1,1,1-trifluoro-5-oxopentan-3-yl]octanamide.
| Compound Name | N-[5-amino-2-(ethylamino)-1,1,1-trifluoro-5-oxopentan-3-yl]octanamide |
|---|---|
| PubChem CID | 166884715 |
| Molecular Formula | C15H28F3N3O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-[5-amino-2-(ethylamino)-1,1,1-trifluoro-5-oxopentan-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)NC(CC(N)=O)C(NCC)C(F)(F)F |
| InChI | InChI=1S/C15H28F3N3O2/c1-3-5-6-7-8-9-13(23)21-11(10-12(19)22)14(20-4-2)15(16,17)18/h11,14,20H,3-10H2,1-2H3,(H2,19,22)(H,21,23) |
| InChIKey | HAOUNCZKDYPSIQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|