C13H23F3N2O3 — CID 162387244
N-[(3R)-5-amino-1,1,1-trifluoro-2-hydroxy-5-oxopentan-3-yl]octanamide (PubChem CID 162387244) has the molecular formula C13H23F3N2O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[(3R)-5-amino-1,1,1-trifluoro-2-hydroxy-5-oxopentan-3-yl]octanamide.
| Compound Name | N-[(3R)-5-amino-1,1,1-trifluoro-2-hydroxy-5-oxopentan-3-yl]octanamide |
|---|---|
| PubChem CID | 162387244 |
| Molecular Formula | C13H23F3N2O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[(3R)-5-amino-1,1,1-trifluoro-2-hydroxy-5-oxopentan-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(O)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O3/c1-2-3-4-5-6-7-11(20)18-9(8-10(17)19)12(21)13(14,15)16/h9,12,21H,2-8H2,1H3,(H2,17,19)(H,18,20)/t9-,12?/m1/s1 |
| InChIKey | AGPQPEKOKSWOKG-PKEIRNPWSA-N |
| XLogP | 1.63 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|