C18H29N3O5 — CID 170223156
1-[6-[2-[2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]propan-1-one (PubChem CID 170223156) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[6-[2-[2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]propan-1-one.
| Compound Name | 1-[6-[2-[2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 170223156 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-[6-[2-[2-[2-(2-prop-1-en-2-yloxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]propan-1-one |
| SMILES | C=C(C)OCCOCCOCCOCCNc1ccc(C(=O)CC)nn1 |
| InChI | InChI=1S/C18H29N3O5/c1-4-17(22)16-5-6-18(21-20-16)19-7-8-23-9-10-24-11-12-25-13-14-26-15(2)3/h5-6H,2,4,7-14H2,1,3H3,(H,19,21) |
| InChIKey | BWHSRZRKEDZAFP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|