C18H31N3O5 — CID 177358408
1-[6-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]-2-methylpropan-1-one (PubChem CID 177358408) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[6-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]-2-methylpropan-1-one.
| Compound Name | 1-[6-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 177358408 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-[6-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethylamino]pyridazin-3-yl]-2-methylpropan-1-one |
| SMILES | CCOCCOCCOCCOCCNc1ccc(C(=O)C(C)C)nn1 |
| InChI | InChI=1S/C18H31N3O5/c1-4-23-9-10-25-13-14-26-12-11-24-8-7-19-17-6-5-16(20-21-17)18(22)15(2)3/h5-6,15H,4,7-14H2,1-3H3,(H,19,21) |
| InChIKey | ZBOWEEULBGMLEE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|