C26H21IN2S — CID 170231087
(3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl) thiohypoiodite (PubChem CID 170231087) has the molecular formula C26H21IN2S and a molecular weight of 520.44 g/mol. Its IUPAC name is (3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl) thiohypoiodite.
| Compound Name | (3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl) thiohypoiodite |
|---|---|
| PubChem CID | 170231087 |
| Molecular Formula | C26H21IN2S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | (3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl) thiohypoiodite |
| SMILES | Cc1cc(C(C)(C)C)c2c(c1)c1nccc3cc(SI)c4c5ccccc5n2c4c31 |
| InChI | InChI=1S/C26H21IN2S/c1-14-11-17-23-21-15(9-10-28-23)13-20(30-27)22-16-7-5-6-8-19(16)29(25(21)22)24(17)18(12-14)26(2,3)4/h5-13H,1-4H3 |
| InChIKey | MHFOSYHSHWZHGE-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|