C41H44N2 — CID 170231122
3-tert-butyl-5-methyl-14-[2,4,6-tri(propan-2-yl)phenyl]-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaene (PubChem CID 170231122) has the molecular formula C41H44N2 and a molecular weight of 564.82 g/mol. Its IUPAC name is 3-tert-butyl-5-methyl-14-[2,4,6-tri(propan-2-yl)phenyl]-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaene.
| Compound Name | 3-tert-butyl-5-methyl-14-[2,4,6-tri(propan-2-yl)phenyl]-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaene |
|---|---|
| PubChem CID | 170231122 |
| Molecular Formula | C41H44N2 |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | 3-tert-butyl-5-methyl-14-[2,4,6-tri(propan-2-yl)phenyl]-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaene |
| SMILES | Cc1cc(C(C)(C)C)c2c(c1)c1nccc3cc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)c4c5ccccc5n2c4c31 |
| InChI | InChI=1S/C41H44N2/c1-22(2)27-20-29(23(3)4)36(30(21-27)24(5)6)31-19-26-15-16-42-38-32-17-25(7)18-33(41(8,9)10)39(32)43-34-14-12-11-13-28(34)37(31)40(43)35(26)38/h11-24H,1-10H3 |
| InChIKey | BAPNNFKGLFQTRU-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|