C15H25N3 — CID 170231382
5-[(E)-2-ethenyl-3-propylhex-1-enyl]-2-methyl-1H-imidazol-4-amine (PubChem CID 170231382) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 5-[(E)-2-ethenyl-3-propylhex-1-enyl]-2-methyl-1H-imidazol-4-amine.
| Compound Name | 5-[(E)-2-ethenyl-3-propylhex-1-enyl]-2-methyl-1H-imidazol-4-amine |
|---|---|
| PubChem CID | 170231382 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 5-[(E)-2-ethenyl-3-propylhex-1-enyl]-2-methyl-1H-imidazol-4-amine |
| SMILES | C=C/C(=C\c1[nH]c(C)nc1N)C(CCC)CCC |
| InChI | InChI=1S/C15H25N3/c1-5-8-13(9-6-2)12(7-3)10-14-15(16)18-11(4)17-14/h7,10,13H,3,5-6,8-9,16H2,1-2,4H3,(H,17,18)/b12-10+ |
| InChIKey | UKDSTMYAKZVHFI-ZRDIBKRKSA-N |
| XLogP | 4.09 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|