C16H18BrN3O3S — CID 17023445
N-(5-bromoquinolin-8-yl)-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 17023445) has the molecular formula C16H18BrN3O3S and a molecular weight of 412.31 g/mol. Its IUPAC name is N-(5-bromoquinolin-8-yl)-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-bromoquinolin-8-yl)-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 17023445 |
| Molecular Formula | C16H18BrN3O3S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-(5-bromoquinolin-8-yl)-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)Nc2ccc(Br)c3cccnc23)C1 |
| InChI | InChI=1S/C16H18BrN3O3S/c1-24(22,23)20-9-3-4-11(10-20)16(21)19-14-7-6-13(17)12-5-2-8-18-15(12)14/h2,5-8,11H,3-4,9-10H2,1H3,(H,19,21) |
| InChIKey | HTAWKTAMGBECOD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |