C19H34N2O2 — CID 170243907
(4Z)-4-ethyl-5-methyl-3-[2-[2-(methylamino)ethoxy]hexylimino]hepta-4,6-dien-2-one (PubChem CID 170243907) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is (4Z)-4-ethyl-5-methyl-3-[2-[2-(methylamino)ethoxy]hexylimino]hepta-4,6-dien-2-one.
| Compound Name | (4Z)-4-ethyl-5-methyl-3-[2-[2-(methylamino)ethoxy]hexylimino]hepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 170243907 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | (4Z)-4-ethyl-5-methyl-3-[2-[2-(methylamino)ethoxy]hexylimino]hepta-4,6-dien-2-one |
| SMILES | C=C/C(C)=C(CC)\C(=N\CC(CCCC)OCCNC)C(C)=O |
| InChI | InChI=1S/C19H34N2O2/c1-7-10-11-17(23-13-12-20-6)14-21-19(16(5)22)18(9-3)15(4)8-2/h8,17,20H,2,7,9-14H2,1,3-6H3/b18-15-,21-19+ |
| InChIKey | VRGVYOSIYAVGRV-XDSJKDRXSA-N |
| XLogP | 3.72 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|