C12H14FN — CID 170244847
(2E)-1-(2-fluorophenyl)-3-methylpenta-2,4-dien-2-amine (PubChem CID 170244847) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is (2E)-1-(2-fluorophenyl)-3-methylpenta-2,4-dien-2-amine.
| Compound Name | (2E)-1-(2-fluorophenyl)-3-methylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 170244847 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (2E)-1-(2-fluorophenyl)-3-methylpenta-2,4-dien-2-amine |
| SMILES | C=C/C(C)=C(/N)Cc1ccccc1F |
| InChI | InChI=1S/C12H14FN/c1-3-9(2)12(14)8-10-6-4-5-7-11(10)13/h3-7H,1,8,14H2,2H3/b12-9+ |
| InChIKey | RUDMXCXMTPNJRT-FMIVXFBMSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|