C13H26N2 — CID 170246540
8,9-dimethyl-2-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 170246540) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 8,9-dimethyl-2-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 8,9-dimethyl-2-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 170246540 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 8,9-dimethyl-2-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CC1CCN2CCN(C(C)C)CC2C1C |
| InChI | InChI=1S/C13H26N2/c1-10(2)15-8-7-14-6-5-11(3)12(4)13(14)9-15/h10-13H,5-9H2,1-4H3 |
| InChIKey | PLLWJAGQPZFNKT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |