C28H37FN6O5 — CID 170254276
11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]-methylamino]-3-methylpentanoyl]amino]-12-oxo-N-(1H-pyrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 170254276) has the molecular formula C28H37FN6O5 and a molecular weight of 556.64 g/mol. Its IUPAC name is 11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]-methylamino]-3-methylpentanoyl]amino]-12-oxo-N-(1H-pyrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | 11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]-methylamino]-3-methylpentanoyl]amino]-12-oxo-N-(1H-pyrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 170254276 |
| Molecular Formula | C28H37FN6O5 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]-methylamino]-3-methylpentanoyl]amino]-12-oxo-N-(1H-pyrazol-5-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC1CCc2cccc3c2N(C1=O)C(C(=O)NCc1ccn[nH]1)C3)N(C)C(=O)COCCF |
| InChI | InChI=1S/C28H37FN6O5/c1-4-17(2)24(34(3)23(36)16-40-13-11-29)27(38)32-21-9-8-18-6-5-7-19-14-22(35(25(18)19)28(21)39)26(37)30-15-20-10-12-31-33-20/h5-7,10,12,17,21-22,24H,4,8-9,11,13-16H2,1-3H3,(H,30,37)(H,31,33)(H,32,38)/t17-,21?,22?,24-/m0/s1 |
| InChIKey | GJKIEZKJGJVKBS-ZADCMUIHSA-N |
| XLogP | 1.27 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|