C24H33FN4O7S — CID 155326230
[[(2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]methanesulfinic acid (PubChem CID 155326230) has the molecular formula C24H33FN4O7S and a molecular weight of 540.61 g/mol. Its IUPAC name is [[(2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]methanesulfinic acid.
| Compound Name | [[(2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]methanesulfinic acid |
|---|---|
| PubChem CID | 155326230 |
| Molecular Formula | C24H33FN4O7S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | [[(2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]methanesulfinic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)COCCF)C(=O)N[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NCS(=O)O)C3 |
| InChI | InChI=1S/C24H33FN4O7S/c1-3-14(2)20(28-19(30)12-36-10-9-25)23(32)27-17-8-7-15-5-4-6-16-11-18(22(31)26-13-37(34)35)29(21(15)16)24(17)33/h4-6,14,17-18,20H,3,7-13H2,1-2H3,(H,26,31)(H,27,32)(H,28,30)(H,34,35)/t14-,17-,18-,20-/m0/s1 |
| InChIKey | XRZSOLOBZUCILC-RNVRALISSA-N |
| XLogP | 0.19 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|