C24H32FN3O7 — CID 155317510
(2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-6-(hydroxymethyl)-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxylic acid (PubChem CID 155317510) has the molecular formula C24H32FN3O7 and a molecular weight of 493.53 g/mol. Its IUPAC name is (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-6-(hydroxymethyl)-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxylic acid.
| Compound Name | (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-6-(hydroxymethyl)-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 155317510 |
| Molecular Formula | C24H32FN3O7 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-6-(hydroxymethyl)-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxylic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)COCCF)C(=O)N[C@H]1CCc2cc(CO)cc3c2N(C1=O)[C@H](C(=O)O)C3 |
| InChI | InChI=1S/C24H32FN3O7/c1-3-13(2)20(27-19(30)12-35-7-6-25)22(31)26-17-5-4-15-8-14(11-29)9-16-10-18(24(33)34)28(21(15)16)23(17)32/h8-9,13,17-18,20,29H,3-7,10-12H2,1-2H3,(H,26,31)(H,27,30)(H,33,34)/t13-,17-,18-,20-/m0/s1 |
| InChIKey | GIQXHVVCPFZOEQ-RMXWXBJUSA-N |
| XLogP | 0.47 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|