C22H28FN3O6S — CID 155317386
(2S,11R)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-9-thia-1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid (PubChem CID 155317386) has the molecular formula C22H28FN3O6S and a molecular weight of 481.55 g/mol. Its IUPAC name is (2S,11R)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-9-thia-1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid.
| Compound Name | (2S,11R)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-9-thia-1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 155317386 |
| Molecular Formula | C22H28FN3O6S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (2S,11R)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-9-thia-1-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)COCCF)C(=O)N[C@H]1CSc2cccc3c2N(C1=O)[C@H](C(=O)O)C3 |
| InChI | InChI=1S/C22H28FN3O6S/c1-3-12(2)18(25-17(27)10-32-8-7-23)20(28)24-14-11-33-16-6-4-5-13-9-15(22(30)31)26(19(13)16)21(14)29/h4-6,12,14-15,18H,3,7-11H2,1-2H3,(H,24,28)(H,25,27)(H,30,31)/t12-,14-,15-,18-/m0/s1 |
| InChIKey | OKUHOXWMZDMMMR-OWCBBSPXSA-N |
| XLogP | 1.14 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|