C22H29FN4O6 — CID 155317565
(2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1,9-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid (PubChem CID 155317565) has the molecular formula C22H29FN4O6 and a molecular weight of 464.49 g/mol. Its IUPAC name is (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1,9-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid.
| Compound Name | (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1,9-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 155317565 |
| Molecular Formula | C22H29FN4O6 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1,9-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-carboxylic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)COCCF)C(=O)N[C@H]1CNc2cccc3c2N(C1=O)[C@H](C(=O)O)C3 |
| InChI | InChI=1S/C22H29FN4O6/c1-3-12(2)18(26-17(28)11-33-8-7-23)20(29)25-15-10-24-14-6-4-5-13-9-16(22(31)32)27(19(13)14)21(15)30/h4-6,12,15-16,18,24H,3,7-11H2,1-2H3,(H,25,29)(H,26,28)(H,31,32)/t12-,15-,16-,18-/m0/s1 |
| InChIKey | VNSLFZCFCBTWHZ-RPZXMPESSA-N |
| XLogP | 0.46 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|