C30H36ClFN4O5 — CID 155644014
(2S,11S)-N-[(4-chlorophenyl)methyl]-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 155644014) has the molecular formula C30H36ClFN4O5 and a molecular weight of 587.09 g/mol. Its IUPAC name is (2S,11S)-N-[(4-chlorophenyl)methyl]-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | (2S,11S)-N-[(4-chlorophenyl)methyl]-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 155644014 |
| Molecular Formula | C30H36ClFN4O5 |
| Molecular Weight | 587.09 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | (2S,11S)-N-[(4-chlorophenyl)methyl]-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)COCCF)C(=O)N[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NCc1ccc(Cl)cc1)C3 |
| InChI | InChI=1S/C30H36ClFN4O5/c1-3-18(2)26(35-25(37)17-41-14-13-32)29(39)34-23-12-9-20-5-4-6-21-15-24(36(27(20)21)30(23)40)28(38)33-16-19-7-10-22(31)11-8-19/h4-8,10-11,18,23-24,26H,3,9,12-17H2,1-2H3,(H,33,38)(H,34,39)(H,35,37)/t18-,23-,24-,26-/m0/s1 |
| InChIKey | DZEFKCMOGRIGGQ-UJRCAEAVSA-N |
| XLogP | 2.86 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|