C30H37FN4O6 — CID 155317418
(2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-N-[(3-hydroxyphenyl)methyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 155317418) has the molecular formula C30H37FN4O6 and a molecular weight of 568.65 g/mol. Its IUPAC name is (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-N-[(3-hydroxyphenyl)methyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-N-[(3-hydroxyphenyl)methyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 155317418 |
| Molecular Formula | C30H37FN4O6 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | (2S,11S)-11-[[(2S,3S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylpentanoyl]amino]-N-[(3-hydroxyphenyl)methyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)COCCF)C(=O)N[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NCc1cccc(O)c1)C3 |
| InChI | InChI=1S/C30H37FN4O6/c1-3-18(2)26(34-25(37)17-41-13-12-31)29(39)33-23-11-10-20-7-5-8-21-15-24(35(27(20)21)30(23)40)28(38)32-16-19-6-4-9-22(36)14-19/h4-9,14,18,23-24,26,36H,3,10-13,15-17H2,1-2H3,(H,32,38)(H,33,39)(H,34,37)/t18-,23-,24-,26-/m0/s1 |
| InChIKey | ZEZFEDZXYPNXIB-UJRCAEAVSA-N |
| XLogP | 1.91 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|