C30H38N3O3+ — CID 170255034
N-[(18S)-17-(cyclopropylmethyl)-4-hydroxy-18-methyl-17-azapentacyclo[7.5.3.210,14.01,10.02,7]nonadeca-2(7),3,5-trien-13-yl]-1-hydroxy-N-methylpyridin-1-ium-3-carboxamide (PubChem CID 170255034) has the molecular formula C30H38N3O3+ and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[(18S)-17-(cyclopropylmethyl)-4-hydroxy-18-methyl-17-azapentacyclo[7.5.3.210,14.01,10.02,7]nonadeca-2(7),3,5-trien-13-yl]-1-hydroxy-N-methylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[(18S)-17-(cyclopropylmethyl)-4-hydroxy-18-methyl-17-azapentacyclo[7.5.3.210,14.01,10.02,7]nonadeca-2(7),3,5-trien-13-yl]-1-hydroxy-N-methylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 170255034 |
| Molecular Formula | C30H38N3O3+ |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | N-[(18S)-17-(cyclopropylmethyl)-4-hydroxy-18-methyl-17-azapentacyclo[7.5.3.210,14.01,10.02,7]nonadeca-2(7),3,5-trien-13-yl]-1-hydroxy-N-methylpyridin-1-ium-3-carboxamide |
| SMILES | CC1CC23CCC(N(C)C(=O)c4ccc[n+](O)c4)C1C21CCN(CC2CC2)C3Cc2ccc(O)cc21 |
| InChI | InChI=1S/C30H37N3O3/c1-19-16-29-10-9-25(31(2)28(35)22-4-3-12-33(36)18-22)27(19)30(29)11-13-32(17-20-5-6-20)26(29)14-21-7-8-23(34)15-24(21)30/h3-4,7-8,12,15,18-20,25-27H,5-6,9-11,13-14,16-17H2,1-2H3,(H-,34,36)/p+1 |
| InChIKey | JRZRRCALJMHZGX-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 67.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|