C20H18F3N3O2 — CID 170259050
2-[4-[(3-hydroxycyclobutyl)amino]phthalazin-1-yl]-3-methyl-5-(trifluoromethyl)phenol (PubChem CID 170259050) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 2-[4-[(3-hydroxycyclobutyl)amino]phthalazin-1-yl]-3-methyl-5-(trifluoromethyl)phenol.
| Compound Name | 2-[4-[(3-hydroxycyclobutyl)amino]phthalazin-1-yl]-3-methyl-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 170259050 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[4-[(3-hydroxycyclobutyl)amino]phthalazin-1-yl]-3-methyl-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc(C(F)(F)F)cc(O)c1-c1nnc(NC2CC(O)C2)c2ccccc12 |
| InChI | InChI=1S/C20H18F3N3O2/c1-10-6-11(20(21,22)23)7-16(28)17(10)18-14-4-2-3-5-15(14)19(26-25-18)24-12-8-13(27)9-12/h2-7,12-13,27-28H,8-9H2,1H3,(H,24,26) |
| InChIKey | SBWNLNKWSWQVFS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |