C21H19F3N4O3 — CID 171852356
[(3R,5R)-5-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]piperidin-3-yl] formate (PubChem CID 171852356) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is [(3R,5R)-5-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]piperidin-3-yl] formate.
| Compound Name | [(3R,5R)-5-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]piperidin-3-yl] formate |
|---|---|
| PubChem CID | 171852356 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [(3R,5R)-5-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]piperidin-3-yl] formate |
| SMILES | O=CO[C@H]1CNC[C@H](Nc2nnc(-c3ccc(C(F)(F)F)cc3O)c3ccccc23)C1 |
| InChI | InChI=1S/C21H19F3N4O3/c22-21(23,24)12-5-6-17(18(30)7-12)19-15-3-1-2-4-16(15)20(28-27-19)26-13-8-14(31-11-29)10-25-9-13/h1-7,11,13-14,25,30H,8-10H2,(H,26,28)/t13-,14-/m1/s1 |
| InChIKey | GBBSLWGZLZLCHE-ZIAGYGMSSA-N |
| XLogP | 3.34 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|