C23H25F3N5O3+ — CID 170260463
[(5R)-5-methoxycarbonylpyrrolidin-3-yl]-methylidene-[5-[8-(trifluoromethyl)quinoxalin-5-yl]-5-azaspiro[2.4]heptane-7-carbonyl]azanium (PubChem CID 170260463) has the molecular formula C23H25F3N5O3+ and a molecular weight of 476.48 g/mol. Its IUPAC name is [(5R)-5-methoxycarbonylpyrrolidin-3-yl]-methylidene-[5-[8-(trifluoromethyl)quinoxalin-5-yl]-5-azaspiro[2.4]heptane-7-carbonyl]azanium.
| Compound Name | [(5R)-5-methoxycarbonylpyrrolidin-3-yl]-methylidene-[5-[8-(trifluoromethyl)quinoxalin-5-yl]-5-azaspiro[2.4]heptane-7-carbonyl]azanium |
|---|---|
| PubChem CID | 170260463 |
| Molecular Formula | C23H25F3N5O3+ |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [(5R)-5-methoxycarbonylpyrrolidin-3-yl]-methylidene-[5-[8-(trifluoromethyl)quinoxalin-5-yl]-5-azaspiro[2.4]heptane-7-carbonyl]azanium |
| SMILES | C=[N+](C(=O)C1CN(c2ccc(C(F)(F)F)c3nccnc23)CC12CC2)C1CN[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C23H25F3N5O3/c1-30(13-9-16(29-10-13)21(33)34-2)20(32)15-11-31(12-22(15)5-6-22)17-4-3-14(23(24,25)26)18-19(17)28-8-7-27-18/h3-4,7-8,13,15-16,29H,1,5-6,9-12H2,2H3/q+1/t13?,15?,16-/m1/s1 |
| InChIKey | KCISNZXPPZZCNT-AVVWSFFYSA-N |
| XLogP | 2.01 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|