C22H20ClFN4O — CID 170261499
N-[[3-(3-chloro-4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4-(1,8-naphthyridin-2-yl)butan-1-amine (PubChem CID 170261499) has the molecular formula C22H20ClFN4O and a molecular weight of 410.88 g/mol. Its IUPAC name is N-[[3-(3-chloro-4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4-(1,8-naphthyridin-2-yl)butan-1-amine.
| Compound Name | N-[[3-(3-chloro-4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4-(1,8-naphthyridin-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 170261499 |
| Molecular Formula | C22H20ClFN4O |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[[3-(3-chloro-4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-4-(1,8-naphthyridin-2-yl)butan-1-amine |
| SMILES | Fc1ccc(-c2cc(CNCCCCc3ccc4cccnc4n3)on2)cc1Cl |
| InChI | InChI=1S/C22H20ClFN4O/c23-19-12-16(7-9-20(19)24)21-13-18(29-28-21)14-25-10-2-1-5-17-8-6-15-4-3-11-26-22(15)27-17/h3-4,6-9,11-13,25H,1-2,5,10,14H2 |
| InChIKey | JYASGFFDBIRZLL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|