C16H15N3O4S — CID 17026420
N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-N-cyclopropyl-3-nitrobenzamide (PubChem CID 17026420) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-N-cyclopropyl-3-nitrobenzamide.
| Compound Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-N-cyclopropyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17026420 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-N-cyclopropyl-3-nitrobenzamide |
| SMILES | CC(=O)c1sc(N(C(=O)c2cccc([N+](=O)[O-])c2)C2CC2)nc1C |
| InChI | InChI=1S/C16H15N3O4S/c1-9-14(10(2)20)24-16(17-9)18(12-6-7-12)15(21)11-4-3-5-13(8-11)19(22)23/h3-5,8,12H,6-7H2,1-2H3 |
| InChIKey | UPSQHULFRXLHCR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|