C16H27NO5S — CID 170264839
(3,3-dioxo-4-oxa-3λ6-thiatricyclo[5.2.1.02,6]decan-8-yl) 2-[di(propan-2-yl)amino]acetate (PubChem CID 170264839) has the molecular formula C16H27NO5S and a molecular weight of 345.46 g/mol. Its IUPAC name is (3,3-dioxo-4-oxa-3λ6-thiatricyclo[5.2.1.02,6]decan-8-yl) 2-[di(propan-2-yl)amino]acetate.
| Compound Name | (3,3-dioxo-4-oxa-3λ6-thiatricyclo[5.2.1.02,6]decan-8-yl) 2-[di(propan-2-yl)amino]acetate |
|---|---|
| PubChem CID | 170264839 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (3,3-dioxo-4-oxa-3λ6-thiatricyclo[5.2.1.02,6]decan-8-yl) 2-[di(propan-2-yl)amino]acetate |
| SMILES | CC(C)N(CC(=O)OC1CC2CC1C1COS(=O)(=O)C21)C(C)C |
| InChI | InChI=1S/C16H27NO5S/c1-9(2)17(10(3)4)7-15(18)22-14-6-11-5-12(14)13-8-21-23(19,20)16(11)13/h9-14,16H,5-8H2,1-4H3 |
| InChIKey | CUQQIZSGVKRIHN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|